C11H18ClNO2S2 — CID 54877273
3-chloro-N-methyl-N-[1-(5-methylthiophen-2-yl)ethyl]propane-1-sulfonamide (PubChem CID 54877273) has the molecular formula C11H18ClNO2S2 and a molecular weight of 295.86 g/mol. Its IUPAC name is 3-chloro-N-methyl-N-[1-(5-methylthiophen-2-yl)ethyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-methyl-N-[1-(5-methylthiophen-2-yl)ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 54877273 |
| Molecular Formula | C11H18ClNO2S2 |
| Molecular Weight | 295.86 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 3-chloro-N-methyl-N-[1-(5-methylthiophen-2-yl)ethyl]propane-1-sulfonamide |
| SMILES | Cc1ccc(C(C)N(C)S(=O)(=O)CCCCl)s1 |
| InChI | InChI=1S/C11H18ClNO2S2/c1-9-5-6-11(16-9)10(2)13(3)17(14,15)8-4-7-12/h5-6,10H,4,7-8H2,1-3H3 |
| InChIKey | BRRYSKHSKROFPK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.86 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|