C13H20N2O2 — CID 54879203
N,N-dimethyl-3-[2-(methylaminomethyl)phenoxy]propanamide (PubChem CID 54879203) has the molecular formula C13H20N2O2 and a molecular weight of 236.32 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-(methylaminomethyl)phenoxy]propanamide.
| Compound Name | N,N-dimethyl-3-[2-(methylaminomethyl)phenoxy]propanamide |
|---|---|
| PubChem CID | 54879203 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | N,N-dimethyl-3-[2-(methylaminomethyl)phenoxy]propanamide |
| SMILES | CNCc1ccccc1OCCC(=O)N(C)C |
| InChI | InChI=1S/C13H20N2O2/c1-14-10-11-6-4-5-7-12(11)17-9-8-13(16)15(2)3/h4-7,14H,8-10H2,1-3H3 |
| InChIKey | OZSFDUZLCXPVDW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |