C11H16FN3O2 — CID 54879385
N-(2-amino-4-fluorophenyl)-2-[2-hydroxyethyl(methyl)amino]acetamide (PubChem CID 54879385) has the molecular formula C11H16FN3O2 and a molecular weight of 241.27 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-2-[2-hydroxyethyl(methyl)amino]acetamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-2-[2-hydroxyethyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 54879385 |
| Molecular Formula | C11H16FN3O2 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-2-[2-hydroxyethyl(methyl)amino]acetamide |
| SMILES | CN(CCO)CC(=O)Nc1ccc(F)cc1N |
| InChI | InChI=1S/C11H16FN3O2/c1-15(4-5-16)7-11(17)14-10-3-2-8(12)6-9(10)13/h2-3,6,16H,4-5,7,13H2,1H3,(H,14,17) |
| InChIKey | QYLNRNIXULZQMR-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|