C14H22N4O — CID 54879446
2-[methyl-[3-(propylaminomethyl)imidazo[1,2-a]pyridin-2-yl]amino]ethanol (PubChem CID 54879446) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-[methyl-[3-(propylaminomethyl)imidazo[1,2-a]pyridin-2-yl]amino]ethanol.
| Compound Name | 2-[methyl-[3-(propylaminomethyl)imidazo[1,2-a]pyridin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 54879446 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-[methyl-[3-(propylaminomethyl)imidazo[1,2-a]pyridin-2-yl]amino]ethanol |
| SMILES | CCCNCc1c(N(C)CCO)nc2ccccn12 |
| InChI | InChI=1S/C14H22N4O/c1-3-7-15-11-12-14(17(2)9-10-19)16-13-6-4-5-8-18(12)13/h4-6,8,15,19H,3,7,9-11H2,1-2H3 |
| InChIKey | RKVIFHDZOFIPRQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|