C14H22N2O2S — CID 54879731
2-[4-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]phenyl]ethanethioamide (PubChem CID 54879731) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 2-[4-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]phenyl]ethanethioamide.
| Compound Name | 2-[4-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]phenyl]ethanethioamide |
|---|---|
| PubChem CID | 54879731 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-[4-[2-[ethyl(2-hydroxyethyl)amino]ethoxy]phenyl]ethanethioamide |
| SMILES | CCN(CCO)CCOc1ccc(CC(N)=S)cc1 |
| InChI | InChI=1S/C14H22N2O2S/c1-2-16(7-9-17)8-10-18-13-5-3-12(4-6-13)11-14(15)19/h3-6,17H,2,7-11H2,1H3,(H2,15,19) |
| InChIKey | JHGORBPEJQYEPG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|