About 3-nitropyridin-4-amine
3-nitropyridin-4-amine (PubChem CID 548803) has the molecular formula C5H5N3O2
and a molecular weight of 139.11 g/mol. Its IUPAC name is 3-nitropyridin-4-amine.
Molecular Properties
| Compound Name | 3-nitropyridin-4-amine |
| PubChem CID | 548803 |
| Molecular Formula | C5H5N3O2 |
| Molecular Weight | 139.11 g/mol |
| Exact Mass | 139.04 |
| IUPAC Name | 3-nitropyridin-4-amine |
| SMILES | Nc1ccncc1[N+](=O)[O-] |
| InChI | InChI=1S/C5H5N3O2/c6-4-1-2-7-3-5(4)8(9)10/h1-3H,(H2,6,7) |
| InChIKey | IUPPEELMBOPLDJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.11 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitropyridin-4-amine?
The IUPAC name of 3-nitropyridin-4-amine (CID 548803) is 3-nitropyridin-4-amine.
What is the SMILES notation for 3-nitropyridin-4-amine?
The canonical SMILES for 3-nitropyridin-4-amine is Nc1ccncc1[N+](=O)[O-].
What is the InChIKey of 3-nitropyridin-4-amine?
The InChIKey is IUPPEELMBOPLDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O2/c6-4-1-2-7-3-5(4)8(9)10/h1-3H,(H2,6,7).
What are the key properties of 3-nitropyridin-4-amine?
3-nitropyridin-4-amine has a molecular weight of 139.11 g/mol, XLogP of 0.57, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitropyridin-4-amine is sourced from PubChem (CID 548803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).