C11H12N4O2 — CID 54880577
2-(1H-1,2,4-triazol-5-ylmethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 54880577) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazol-5-ylmethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-(1H-1,2,4-triazol-5-ylmethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 54880577 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-(1H-1,2,4-triazol-5-ylmethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2CC=CCC2C(=O)N1Cc1ncn[nH]1 |
| InChI | InChI=1S/C11H12N4O2/c16-10-7-3-1-2-4-8(7)11(17)15(10)5-9-12-6-13-14-9/h1-2,6-8H,3-5H2,(H,12,13,14) |
| InChIKey | KOMJJNGOOXJVLJ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|