C13H18N4O2 — CID 54880588
3-(1H-1,2,4-triazol-5-ylmethyl)-3-azaspiro[5.5]undecane-2,4-dione (PubChem CID 54880588) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-(1H-1,2,4-triazol-5-ylmethyl)-3-azaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-(1H-1,2,4-triazol-5-ylmethyl)-3-azaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 54880588 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-(1H-1,2,4-triazol-5-ylmethyl)-3-azaspiro[5.5]undecane-2,4-dione |
| SMILES | O=C1CC2(CCCCC2)CC(=O)N1Cc1ncn[nH]1 |
| InChI | InChI=1S/C13H18N4O2/c18-11-6-13(4-2-1-3-5-13)7-12(19)17(11)8-10-14-9-15-16-10/h9H,1-8H2,(H,14,15,16) |
| InChIKey | VRZXYWMNWUHYMH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|