C12H10N4O2 — CID 54880599
2-(1H-1,2,4-triazol-5-ylmethyl)-4H-isoquinoline-1,3-dione (PubChem CID 54880599) has the molecular formula C12H10N4O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazol-5-ylmethyl)-4H-isoquinoline-1,3-dione.
| Compound Name | 2-(1H-1,2,4-triazol-5-ylmethyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 54880599 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-(1H-1,2,4-triazol-5-ylmethyl)-4H-isoquinoline-1,3-dione |
| SMILES | O=C1Cc2ccccc2C(=O)N1Cc1ncn[nH]1 |
| InChI | InChI=1S/C12H10N4O2/c17-11-5-8-3-1-2-4-9(8)12(18)16(11)6-10-13-7-14-15-10/h1-4,7H,5-6H2,(H,13,14,15) |
| InChIKey | BNNCPUWJZGVZML-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|