About 7H-purine-8-carbaldehyde
7H-purine-8-carbaldehyde (PubChem CID 548806) has the molecular formula C6H4N4O
and a molecular weight of 148.12 g/mol. Its IUPAC name is 7H-purine-8-carbaldehyde.
Molecular Properties
| Compound Name | 7H-purine-8-carbaldehyde |
| PubChem CID | 548806 |
| Molecular Formula | C6H4N4O |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | 7H-purine-8-carbaldehyde |
| SMILES | O=Cc1nc2ncncc2[nH]1 |
| InChI | InChI=1S/C6H4N4O/c11-2-5-9-4-1-7-3-8-6(4)10-5/h1-3H,(H,7,8,9,10) |
| InChIKey | CBAXVPCTBZORMR-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7H-purine-8-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purine-8-carbaldehyde?
The IUPAC name of 7H-purine-8-carbaldehyde (CID 548806) is 7H-purine-8-carbaldehyde.
What is the SMILES notation for 7H-purine-8-carbaldehyde?
The canonical SMILES for 7H-purine-8-carbaldehyde is O=Cc1nc2ncncc2[nH]1.
What is the InChIKey of 7H-purine-8-carbaldehyde?
The InChIKey is CBAXVPCTBZORMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O/c11-2-5-9-4-1-7-3-8-6(4)10-5/h1-3H,(H,7,8,9,10).
What are the key properties of 7H-purine-8-carbaldehyde?
7H-purine-8-carbaldehyde has a molecular weight of 148.12 g/mol, XLogP of 0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purine-8-carbaldehyde is sourced from PubChem (CID 548806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).