C15H21N3O — CID 54880689
N-[2-(1-cyanobutan-2-ylamino)ethyl]-4-methylbenzamide (PubChem CID 54880689) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is N-[2-(1-cyanobutan-2-ylamino)ethyl]-4-methylbenzamide.
| Compound Name | N-[2-(1-cyanobutan-2-ylamino)ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 54880689 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-[2-(1-cyanobutan-2-ylamino)ethyl]-4-methylbenzamide |
| SMILES | CCC(CC#N)NCCNC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H21N3O/c1-3-14(8-9-16)17-10-11-18-15(19)13-6-4-12(2)5-7-13/h4-7,14,17H,3,8,10-11H2,1-2H3,(H,18,19) |
| InChIKey | KAZWPXSFAXTULF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|