About N'-aminoethanimidamide
N'-aminoethanimidamide (PubChem CID 5488081) has the molecular formula C2H7N3
and a molecular weight of 73.10 g/mol. Its IUPAC name is N'-aminoethanimidamide.
Molecular Properties
| Compound Name | N'-aminoethanimidamide |
| PubChem CID | 5488081 |
| Molecular Formula | C2H7N3 |
| Molecular Weight | 73.10 g/mol |
| Exact Mass | 73.06 |
| IUPAC Name | N'-aminoethanimidamide |
| SMILES | C/C(N)=N\N |
| InChI | InChI=1S/C2H7N3/c1-2(3)5-4/h4H2,1H3,(H2,3,5) |
| InChIKey | MIDZOHILFFUXMZ-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 73.10 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-aminoethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-aminoethanimidamide?
The IUPAC name of N'-aminoethanimidamide (CID 5488081) is N'-aminoethanimidamide.
What is the SMILES notation for N'-aminoethanimidamide?
The canonical SMILES for N'-aminoethanimidamide is C/C(N)=N\N.
What is the InChIKey of N'-aminoethanimidamide?
The InChIKey is MIDZOHILFFUXMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7N3/c1-2(3)5-4/h4H2,1H3,(H2,3,5).
What are the key properties of N'-aminoethanimidamide?
N'-aminoethanimidamide has a molecular weight of 73.10 g/mol, XLogP of -0.76, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-aminoethanimidamide is sourced from PubChem (CID 5488081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).