C8H9N3O2 — CID 548811
4-methyl-2,4,6-triazatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 548811) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 4-methyl-2,4,6-triazatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-methyl-2,4,6-triazatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 548811 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 4-methyl-2,4,6-triazatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | Cn1c(=O)n2n(c1=O)C1C=CC2C1 |
| InChI | InChI=1S/C8H9N3O2/c1-9-7(12)10-5-2-3-6(4-5)11(10)8(9)13/h2-3,5-6H,4H2,1H3 |
| InChIKey | QWJZPXDTVSNMNS-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|