C12H12O2 — CID 548815
4-methyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 548815) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-methyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | 4-methyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 548815 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 4-methyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | CC1=CC(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C12H12O2/c1-6-4-9(13)10-7-2-3-8(5-7)11(10)12(6)14/h2-4,7-8,10-11H,5H2,1H3 |
| InChIKey | VVJNELUVYOGFDK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|