2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid

C13H13NO3S — CID 54881676

IUPAC2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid
SMILESCc1nc(CSc2ccccc2C(=O)O)oc1C
InChIInChI=1S/C13H13NO3S/c1-8-9(2)17-12(14-8)7-18-11-6-4-3-5-10(11)13(15)16/h3-6H,7H2,1-2H3,(H,15,16)
InChIKeyXTBAWUQAVLGJDX-UHFFFAOYSA-N
MW263.32 g/mol
LogP3.28
Rot. Bonds4

About 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid

2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid (PubChem CID 54881676) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid.

Molecular Properties

Compound Name2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid
PubChem CID54881676
Molecular FormulaC13H13NO3S
Molecular Weight263.32 g/mol
Exact Mass263.06
IUPAC Name2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid
SMILESCc1nc(CSc2ccccc2C(=O)O)oc1C
InChIInChI=1S/C13H13NO3S/c1-8-9(2)17-12(14-8)7-18-11-6-4-3-5-10(11)13(15)16/h3-6H,7H2,1-2H3,(H,15,16)
InChIKeyXTBAWUQAVLGJDX-UHFFFAOYSA-N
XLogP3.28
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.32
LogP ≤ 53.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid?
The IUPAC name of 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid (CID 54881676) is 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid.
What is the SMILES notation for 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid?
The canonical SMILES for 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid is Cc1nc(CSc2ccccc2C(=O)O)oc1C.
What is the InChIKey of 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid?
The InChIKey is XTBAWUQAVLGJDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3S/c1-8-9(2)17-12(14-8)7-18-11-6-4-3-5-10(11)13(15)16/h3-6H,7H2,1-2H3,(H,15,16).
What are the key properties of 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid?
2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid has a molecular weight of 263.32 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methylsulfanyl]benzoic acid is sourced from PubChem (CID 54881676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).