About (2S)-2-(1,3-thiazol-2-ylamino)propanoic acid
(2S)-2-(1,3-thiazol-2-ylamino)propanoic acid (PubChem CID 5488184) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is (2S)-2-(1,3-thiazol-2-ylamino)propanoic acid.
Molecular Properties
| Compound Name | (2S)-2-(1,3-thiazol-2-ylamino)propanoic acid |
| PubChem CID | 5488184 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | (2S)-2-(1,3-thiazol-2-ylamino)propanoic acid |
| SMILES | C[C@H](Nc1nccs1)C(=O)O |
| InChI | InChI=1S/C6H8N2O2S/c1-4(5(9)10)8-6-7-2-3-11-6/h2-4H,1H3,(H,7,8)(H,9,10)/t4-/m0/s1 |
| InChIKey | YYAYLSOQGBAUHK-BYPYZUCNSA-N |
| XLogP | 1.03 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-(1,3-thiazol-2-ylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(1,3-thiazol-2-ylamino)propanoic acid?
The IUPAC name of (2S)-2-(1,3-thiazol-2-ylamino)propanoic acid (CID 5488184) is (2S)-2-(1,3-thiazol-2-ylamino)propanoic acid.
What is the SMILES notation for (2S)-2-(1,3-thiazol-2-ylamino)propanoic acid?
The canonical SMILES for (2S)-2-(1,3-thiazol-2-ylamino)propanoic acid is C[C@H](Nc1nccs1)C(=O)O.
What is the InChIKey of (2S)-2-(1,3-thiazol-2-ylamino)propanoic acid?
The InChIKey is YYAYLSOQGBAUHK-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-4(5(9)10)8-6-7-2-3-11-6/h2-4H,1H3,(H,7,8)(H,9,10)/t4-/m0/s1.
What are the key properties of (2S)-2-(1,3-thiazol-2-ylamino)propanoic acid?
(2S)-2-(1,3-thiazol-2-ylamino)propanoic acid has a molecular weight of 172.21 g/mol, XLogP of 1.03, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(1,3-thiazol-2-ylamino)propanoic acid is sourced from PubChem (CID 5488184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).