C10H13NO5S — CID 54882569
5-(2-methylpyrrolidin-1-yl)sulfonylfuran-2-carboxylic acid (PubChem CID 54882569) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is 5-(2-methylpyrrolidin-1-yl)sulfonylfuran-2-carboxylic acid.
| Compound Name | 5-(2-methylpyrrolidin-1-yl)sulfonylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 54882569 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 5-(2-methylpyrrolidin-1-yl)sulfonylfuran-2-carboxylic acid |
| SMILES | CC1CCCN1S(=O)(=O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C10H13NO5S/c1-7-3-2-6-11(7)17(14,15)9-5-4-8(16-9)10(12)13/h4-5,7H,2-3,6H2,1H3,(H,12,13) |
| InChIKey | AVNKBLQUYBWIDX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |