C7H12N4O4S2 — CID 54883587
1,1-dioxo-N-(1H-1,2,4-triazol-5-ylmethyl)thiolane-3-sulfonamide (PubChem CID 54883587) has the molecular formula C7H12N4O4S2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 1,1-dioxo-N-(1H-1,2,4-triazol-5-ylmethyl)thiolane-3-sulfonamide.
| Compound Name | 1,1-dioxo-N-(1H-1,2,4-triazol-5-ylmethyl)thiolane-3-sulfonamide |
|---|---|
| PubChem CID | 54883587 |
| Molecular Formula | C7H12N4O4S2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 1,1-dioxo-N-(1H-1,2,4-triazol-5-ylmethyl)thiolane-3-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)NCc2ncn[nH]2)C1 |
| InChI | InChI=1S/C7H12N4O4S2/c12-16(13)2-1-6(4-16)17(14,15)10-3-7-8-5-9-11-7/h5-6,10H,1-4H2,(H,8,9,11) |
| InChIKey | OKUJGBYYVXUYIU-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |