About methyl hexa-2,5-dienoate
methyl hexa-2,5-dienoate (PubChem CID 548845) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is methyl hexa-2,5-dienoate.
Molecular Properties
| Compound Name | methyl hexa-2,5-dienoate |
| PubChem CID | 548845 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | methyl hexa-2,5-dienoate |
| SMILES | C=CCC=CC(=O)OC |
| InChI | InChI=1S/C7H10O2/c1-3-4-5-6-7(8)9-2/h3,5-6H,1,4H2,2H3 |
| InChIKey | ODLGSRPFJDMGNW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl hexa-2,5-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl hexa-2,5-dienoate?
The IUPAC name of methyl hexa-2,5-dienoate (CID 548845) is methyl hexa-2,5-dienoate.
What is the SMILES notation for methyl hexa-2,5-dienoate?
The canonical SMILES for methyl hexa-2,5-dienoate is C=CCC=CC(=O)OC.
What is the InChIKey of methyl hexa-2,5-dienoate?
The InChIKey is ODLGSRPFJDMGNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-3-4-5-6-7(8)9-2/h3,5-6H,1,4H2,2H3.
What are the key properties of methyl hexa-2,5-dienoate?
methyl hexa-2,5-dienoate has a molecular weight of 126.15 g/mol, XLogP of 1.29, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl hexa-2,5-dienoate is sourced from PubChem (CID 548845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).