C13H17N5O — CID 54884735
N-[3-[1-(1H-1,2,4-triazol-5-ylmethylamino)ethyl]phenyl]acetamide (PubChem CID 54884735) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is N-[3-[1-(1H-1,2,4-triazol-5-ylmethylamino)ethyl]phenyl]acetamide.
| Compound Name | N-[3-[1-(1H-1,2,4-triazol-5-ylmethylamino)ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 54884735 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-[3-[1-(1H-1,2,4-triazol-5-ylmethylamino)ethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C(C)NCc2ncn[nH]2)c1 |
| InChI | InChI=1S/C13H17N5O/c1-9(14-7-13-15-8-16-18-13)11-4-3-5-12(6-11)17-10(2)19/h3-6,8-9,14H,7H2,1-2H3,(H,17,19)(H,15,16,18) |
| InChIKey | KEYBKUWBASVQDI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |