C8H11N7O2 — CID 54884938
2,4-dimethyl-6-(1H-1,2,4-triazol-5-ylmethylamino)-1,2,4-triazine-3,5-dione (PubChem CID 54884938) has the molecular formula C8H11N7O2 and a molecular weight of 237.22 g/mol. Its IUPAC name is 2,4-dimethyl-6-(1H-1,2,4-triazol-5-ylmethylamino)-1,2,4-triazine-3,5-dione.
| Compound Name | 2,4-dimethyl-6-(1H-1,2,4-triazol-5-ylmethylamino)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 54884938 |
| Molecular Formula | C8H11N7O2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2,4-dimethyl-6-(1H-1,2,4-triazol-5-ylmethylamino)-1,2,4-triazine-3,5-dione |
| SMILES | Cn1nc(NCc2ncn[nH]2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C8H11N7O2/c1-14-7(16)6(13-15(2)8(14)17)9-3-5-10-4-11-12-5/h4H,3H2,1-2H3,(H,9,13)(H,10,11,12) |
| InChIKey | VZHMAEGWPROLMZ-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |