About N-(1H-1,2,4-triazol-5-ylmethyl)nonanamide
N-(1H-1,2,4-triazol-5-ylmethyl)nonanamide (PubChem CID 54885147) has the molecular formula C12H22N4O
and a molecular weight of 238.33 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-ylmethyl)nonanamide.
Molecular Properties
| Compound Name | N-(1H-1,2,4-triazol-5-ylmethyl)nonanamide |
| PubChem CID | 54885147 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-ylmethyl)nonanamide |
| SMILES | CCCCCCCCC(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C12H22N4O/c1-2-3-4-5-6-7-8-12(17)13-9-11-14-10-15-16-11/h10H,2-9H2,1H3,(H,13,17)(H,14,15,16) |
| InChIKey | LBNMWPQRCDAYMK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(1H-1,2,4-triazol-5-ylmethyl)nonanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-1,2,4-triazol-5-ylmethyl)nonanamide?
The IUPAC name of N-(1H-1,2,4-triazol-5-ylmethyl)nonanamide (CID 54885147) is N-(1H-1,2,4-triazol-5-ylmethyl)nonanamide.
What is the SMILES notation for N-(1H-1,2,4-triazol-5-ylmethyl)nonanamide?
The canonical SMILES for N-(1H-1,2,4-triazol-5-ylmethyl)nonanamide is CCCCCCCCC(=O)NCc1ncn[nH]1.
What is the InChIKey of N-(1H-1,2,4-triazol-5-ylmethyl)nonanamide?
The InChIKey is LBNMWPQRCDAYMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O/c1-2-3-4-5-6-7-8-12(17)13-9-11-14-10-15-16-11/h10H,2-9H2,1H3,(H,13,17)(H,14,15,16).
What are the key properties of N-(1H-1,2,4-triazol-5-ylmethyl)nonanamide?
N-(1H-1,2,4-triazol-5-ylmethyl)nonanamide has a molecular weight of 238.33 g/mol, XLogP of 2.17, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-1,2,4-triazol-5-ylmethyl)nonanamide is sourced from PubChem (CID 54885147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).