C12H17N5O2 — CID 54885174
1-cyclopentyl-3-(1H-1,2,4-triazol-5-ylmethylamino)pyrrolidine-2,5-dione (PubChem CID 54885174) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-cyclopentyl-3-(1H-1,2,4-triazol-5-ylmethylamino)pyrrolidine-2,5-dione.
| Compound Name | 1-cyclopentyl-3-(1H-1,2,4-triazol-5-ylmethylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 54885174 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-cyclopentyl-3-(1H-1,2,4-triazol-5-ylmethylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NCc2ncn[nH]2)C(=O)N1C1CCCC1 |
| InChI | InChI=1S/C12H17N5O2/c18-11-5-9(13-6-10-14-7-15-16-10)12(19)17(11)8-3-1-2-4-8/h7-9,13H,1-6H2,(H,14,15,16) |
| InChIKey | WTSYADXXCWBORO-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|