C10H10F2N4O2S — CID 54885367
2-(difluoromethylsulfonyl)-N-(1H-1,2,4-triazol-5-ylmethyl)aniline (PubChem CID 54885367) has the molecular formula C10H10F2N4O2S and a molecular weight of 288.28 g/mol. Its IUPAC name is 2-(difluoromethylsulfonyl)-N-(1H-1,2,4-triazol-5-ylmethyl)aniline.
| Compound Name | 2-(difluoromethylsulfonyl)-N-(1H-1,2,4-triazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 54885367 |
| Molecular Formula | C10H10F2N4O2S |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-(difluoromethylsulfonyl)-N-(1H-1,2,4-triazol-5-ylmethyl)aniline |
| SMILES | O=S(=O)(c1ccccc1NCc1ncn[nH]1)C(F)F |
| InChI | InChI=1S/C10H10F2N4O2S/c11-10(12)19(17,18)8-4-2-1-3-7(8)13-5-9-14-6-15-16-9/h1-4,6,10,13H,5H2,(H,14,15,16) |
| InChIKey | NJMCMZQJRQQZMN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |