C12H22N4O — CID 54885371
3,5,5-trimethyl-N-(1H-1,2,4-triazol-5-ylmethyl)hexanamide (PubChem CID 54885371) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 3,5,5-trimethyl-N-(1H-1,2,4-triazol-5-ylmethyl)hexanamide.
| Compound Name | 3,5,5-trimethyl-N-(1H-1,2,4-triazol-5-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 54885371 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 3,5,5-trimethyl-N-(1H-1,2,4-triazol-5-ylmethyl)hexanamide |
| SMILES | CC(CC(=O)NCc1ncn[nH]1)CC(C)(C)C |
| InChI | InChI=1S/C12H22N4O/c1-9(6-12(2,3)4)5-11(17)13-7-10-14-8-15-16-10/h8-9H,5-7H2,1-4H3,(H,13,17)(H,14,15,16) |
| InChIKey | WQXXJDYOYHQKRF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |