C10H18F2N2O2S — CID 54885516
4-[1-(difluoromethylsulfonyl)pyrrolidin-2-yl]piperidine (PubChem CID 54885516) has the molecular formula C10H18F2N2O2S and a molecular weight of 268.33 g/mol. Its IUPAC name is 4-[1-(difluoromethylsulfonyl)pyrrolidin-2-yl]piperidine.
| Compound Name | 4-[1-(difluoromethylsulfonyl)pyrrolidin-2-yl]piperidine |
|---|---|
| PubChem CID | 54885516 |
| Molecular Formula | C10H18F2N2O2S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-[1-(difluoromethylsulfonyl)pyrrolidin-2-yl]piperidine |
| SMILES | O=S(=O)(C(F)F)N1CCCC1C1CCNCC1 |
| InChI | InChI=1S/C10H18F2N2O2S/c11-10(12)17(15,16)14-7-1-2-9(14)8-3-5-13-6-4-8/h8-10,13H,1-7H2 |
| InChIKey | SYYAHUINHCWGSD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |