C13H17ClN2O2 — CID 54885733
1-[4-(chloromethyl)-2-nitrophenyl]-2-ethylpyrrolidine (PubChem CID 54885733) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 1-[4-(chloromethyl)-2-nitrophenyl]-2-ethylpyrrolidine.
| Compound Name | 1-[4-(chloromethyl)-2-nitrophenyl]-2-ethylpyrrolidine |
|---|---|
| PubChem CID | 54885733 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-[4-(chloromethyl)-2-nitrophenyl]-2-ethylpyrrolidine |
| SMILES | CCC1CCCN1c1ccc(CCl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17ClN2O2/c1-2-11-4-3-7-15(11)12-6-5-10(9-14)8-13(12)16(17)18/h5-6,8,11H,2-4,7,9H2,1H3 |
| InChIKey | ITBYKPRESZXONU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|