About 3-hydroxy-7,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one
3-hydroxy-7,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one (PubChem CID 5488650) has the molecular formula C17H12O6
and a molecular weight of 312.28 g/mol. Its IUPAC name is 3-hydroxy-7,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one.
Molecular Properties
| Compound Name | 3-hydroxy-7,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one |
| PubChem CID | 5488650 |
| Molecular Formula | C17H12O6 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 3-hydroxy-7,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one |
| SMILES | COc1cc(OC)c2c(c1)oc1c3ccc(O)cc3oc(=O)c12 |
| InChI | InChI=1S/C17H12O6/c1-20-9-6-12(21-2)14-13(7-9)22-16-10-4-3-8(18)5-11(10)23-17(19)15(14)16/h3-7,18H,1-2H3 |
| InChIKey | GYNHMEBOILXPQT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-7,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-7,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one?
The IUPAC name of 3-hydroxy-7,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one (CID 5488650) is 3-hydroxy-7,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one.
What is the SMILES notation for 3-hydroxy-7,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one?
The canonical SMILES for 3-hydroxy-7,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one is COc1cc(OC)c2c(c1)oc1c3ccc(O)cc3oc(=O)c12.
What is the InChIKey of 3-hydroxy-7,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one?
The InChIKey is GYNHMEBOILXPQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O6/c1-20-9-6-12(21-2)14-13(7-9)22-16-10-4-3-8(18)5-11(10)23-17(19)15(14)16/h3-7,18H,1-2H3.
What are the key properties of 3-hydroxy-7,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one?
3-hydroxy-7,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one has a molecular weight of 312.28 g/mol, XLogP of 3.42, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-7,9-dimethoxy-[1]benzofuro[3,2-c]chromen-6-one is sourced from PubChem (CID 5488650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).