C25H33NO3 — CID 5488671
(6S,6aR,9R,10aR)-6-methyl-3-[(2R)-5-phenylpentan-2-yl]oxy-5,6,6a,7,8,9,10,10a-octahydrophenanthridine-1,9-diol (PubChem CID 5488671) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is (6S,6aR,9R,10aR)-6-methyl-3-[(2R)-5-phenylpentan-2-yl]oxy-5,6,6a,7,8,9,10,10a-octahydrophenanthridine-1,9-diol.
| Compound Name | (6S,6aR,9R,10aR)-6-methyl-3-[(2R)-5-phenylpentan-2-yl]oxy-5,6,6a,7,8,9,10,10a-octahydrophenanthridine-1,9-diol |
|---|---|
| PubChem CID | 5488671 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | (6S,6aR,9R,10aR)-6-methyl-3-[(2R)-5-phenylpentan-2-yl]oxy-5,6,6a,7,8,9,10,10a-octahydrophenanthridine-1,9-diol |
| SMILES | C[C@H](CCCc1ccccc1)Oc1cc(O)c2c(c1)N[C@@H](C)[C@@H]1CC[C@@H](O)C[C@@H]21 |
| InChI | InChI=1S/C25H33NO3/c1-16(7-6-10-18-8-4-3-5-9-18)29-20-14-23-25(24(28)15-20)22-13-19(27)11-12-21(22)17(2)26-23/h3-5,8-9,14-17,19,21-22,26-28H,6-7,10-13H2,1-2H3/t16-,17+,19-,21+,22-/m1/s1 |
| InChIKey | YPYQDMBJZJZFQL-LLZYVPLJSA-N |
| XLogP | 5.24 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |