C13H16N2O3 — CID 54887336
2-(3,4-dihydroxyphenyl)-2-(oxolan-2-ylmethylamino)acetonitrile (PubChem CID 54887336) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-2-(oxolan-2-ylmethylamino)acetonitrile.
| Compound Name | 2-(3,4-dihydroxyphenyl)-2-(oxolan-2-ylmethylamino)acetonitrile |
|---|---|
| PubChem CID | 54887336 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-2-(oxolan-2-ylmethylamino)acetonitrile |
| SMILES | N#CC(NCC1CCCO1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H16N2O3/c14-7-11(15-8-10-2-1-5-18-10)9-3-4-12(16)13(17)6-9/h3-4,6,10-11,15-17H,1-2,5,8H2 |
| InChIKey | GVAOGJYQKFRQFK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|