C13H9Cl2NO3 — CID 54888100
5-amino-2-(2,4-dichlorophenoxy)benzoic acid (PubChem CID 54888100) has the molecular formula C13H9Cl2NO3 and a molecular weight of 298.12 g/mol. Its IUPAC name is 5-amino-2-(2,4-dichlorophenoxy)benzoic acid.
| Compound Name | 5-amino-2-(2,4-dichlorophenoxy)benzoic acid |
|---|---|
| PubChem CID | 54888100 |
| Molecular Formula | C13H9Cl2NO3 |
| Molecular Weight | 298.12 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 5-amino-2-(2,4-dichlorophenoxy)benzoic acid |
| SMILES | Nc1ccc(Oc2ccc(Cl)cc2Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H9Cl2NO3/c14-7-1-3-12(10(15)5-7)19-11-4-2-8(16)6-9(11)13(17)18/h1-6H,16H2,(H,17,18) |
| InChIKey | TYDVCXBTSYBYHN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.12 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|