C14H20FN3 — CID 54889234
2-[2-(diethylamino)ethylamino]-2-(2-fluorophenyl)acetonitrile (PubChem CID 54889234) has the molecular formula C14H20FN3 and a molecular weight of 249.33 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylamino]-2-(2-fluorophenyl)acetonitrile.
| Compound Name | 2-[2-(diethylamino)ethylamino]-2-(2-fluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 54889234 |
| Molecular Formula | C14H20FN3 |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 2-[2-(diethylamino)ethylamino]-2-(2-fluorophenyl)acetonitrile |
| SMILES | CCN(CC)CCNC(C#N)c1ccccc1F |
| InChI | InChI=1S/C14H20FN3/c1-3-18(4-2)10-9-17-14(11-16)12-7-5-6-8-13(12)15/h5-8,14,17H,3-4,9-10H2,1-2H3 |
| InChIKey | YCCHEHAMZVRJKO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |