C14H25NO3 — CID 54889565
methyl 3-methyl-1-(oxolan-2-ylmethylamino)cyclohexane-1-carboxylate (PubChem CID 54889565) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is methyl 3-methyl-1-(oxolan-2-ylmethylamino)cyclohexane-1-carboxylate.
| Compound Name | methyl 3-methyl-1-(oxolan-2-ylmethylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54889565 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | methyl 3-methyl-1-(oxolan-2-ylmethylamino)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NCC2CCCO2)CCCC(C)C1 |
| InChI | InChI=1S/C14H25NO3/c1-11-5-3-7-14(9-11,13(16)17-2)15-10-12-6-4-8-18-12/h11-12,15H,3-10H2,1-2H3 |
| InChIKey | VQPWPBVPBDSLSW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |