C16H21NO2 — CID 54889816
methyl 2-cyclohex-3-en-1-yl-2-(2-methylanilino)acetate (PubChem CID 54889816) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is methyl 2-cyclohex-3-en-1-yl-2-(2-methylanilino)acetate.
| Compound Name | methyl 2-cyclohex-3-en-1-yl-2-(2-methylanilino)acetate |
|---|---|
| PubChem CID | 54889816 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | methyl 2-cyclohex-3-en-1-yl-2-(2-methylanilino)acetate |
| SMILES | COC(=O)C(Nc1ccccc1C)C1CC=CCC1 |
| InChI | InChI=1S/C16H21NO2/c1-12-8-6-7-11-14(12)17-15(16(18)19-2)13-9-4-3-5-10-13/h3-4,6-8,11,13,15,17H,5,9-10H2,1-2H3 |
| InChIKey | IIUVIIPBQOQGLC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|