C13H12F3NO2 — CID 54890999
2,3-dimethyl-8-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one (PubChem CID 54890999) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is 2,3-dimethyl-8-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one.
| Compound Name | 2,3-dimethyl-8-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 54890999 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2,3-dimethyl-8-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one |
| SMILES | Cc1[nH]c2c(OCC(F)(F)F)cccc2c(=O)c1C |
| InChI | InChI=1S/C13H12F3NO2/c1-7-8(2)17-11-9(12(7)18)4-3-5-10(11)19-6-13(14,15)16/h3-5H,6H2,1-2H3,(H,17,18) |
| InChIKey | YLVRKUVKSPQHBG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |