About 2-methyl-2-(2,2,2-trifluoroethylamino)nonanamide
2-methyl-2-(2,2,2-trifluoroethylamino)nonanamide (PubChem CID 54892589) has the molecular formula C12H23F3N2O
and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-methyl-2-(2,2,2-trifluoroethylamino)nonanamide.
Molecular Properties
| Compound Name | 2-methyl-2-(2,2,2-trifluoroethylamino)nonanamide |
| PubChem CID | 54892589 |
| Molecular Formula | C12H23F3N2O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 2-methyl-2-(2,2,2-trifluoroethylamino)nonanamide |
| SMILES | CCCCCCCC(C)(NCC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C12H23F3N2O/c1-3-4-5-6-7-8-11(2,10(16)18)17-9-12(13,14)15/h17H,3-9H2,1-2H3,(H2,16,18) |
| InChIKey | WHOPHOZJRPFAFF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-(2,2,2-trifluoroethylamino)nonanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(2,2,2-trifluoroethylamino)nonanamide?
The IUPAC name of 2-methyl-2-(2,2,2-trifluoroethylamino)nonanamide (CID 54892589) is 2-methyl-2-(2,2,2-trifluoroethylamino)nonanamide.
What is the SMILES notation for 2-methyl-2-(2,2,2-trifluoroethylamino)nonanamide?
The canonical SMILES for 2-methyl-2-(2,2,2-trifluoroethylamino)nonanamide is CCCCCCCC(C)(NCC(F)(F)F)C(N)=O.
What is the InChIKey of 2-methyl-2-(2,2,2-trifluoroethylamino)nonanamide?
The InChIKey is WHOPHOZJRPFAFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F3N2O/c1-3-4-5-6-7-8-11(2,10(16)18)17-9-12(13,14)15/h17H,3-9H2,1-2H3,(H2,16,18).
What are the key properties of 2-methyl-2-(2,2,2-trifluoroethylamino)nonanamide?
2-methyl-2-(2,2,2-trifluoroethylamino)nonanamide has a molecular weight of 268.32 g/mol, XLogP of 2.74, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(2,2,2-trifluoroethylamino)nonanamide is sourced from PubChem (CID 54892589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).