About 2-tert-butyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carbonitrile
2-tert-butyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carbonitrile (PubChem CID 54892775) has the molecular formula C13H21F3N2
and a molecular weight of 262.32 g/mol. Its IUPAC name is 2-tert-butyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carbonitrile.
Molecular Properties
| Compound Name | 2-tert-butyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carbonitrile |
| PubChem CID | 54892775 |
| Molecular Formula | C13H21F3N2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-tert-butyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carbonitrile |
| SMILES | CC(C)(C)C1CCCCC1(C#N)NCC(F)(F)F |
| InChI | InChI=1S/C13H21F3N2/c1-11(2,3)10-6-4-5-7-12(10,8-17)18-9-13(14,15)16/h10,18H,4-7,9H2,1-3H3 |
| InChIKey | CSEPUYYIFSEWIC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carbonitrile?
The IUPAC name of 2-tert-butyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carbonitrile (CID 54892775) is 2-tert-butyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carbonitrile.
What is the SMILES notation for 2-tert-butyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carbonitrile?
The canonical SMILES for 2-tert-butyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carbonitrile is CC(C)(C)C1CCCCC1(C#N)NCC(F)(F)F.
What is the InChIKey of 2-tert-butyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carbonitrile?
The InChIKey is CSEPUYYIFSEWIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F3N2/c1-11(2,3)10-6-4-5-7-12(10,8-17)18-9-13(14,15)16/h10,18H,4-7,9H2,1-3H3.
What are the key properties of 2-tert-butyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carbonitrile?
2-tert-butyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carbonitrile has a molecular weight of 262.32 g/mol, XLogP of 3.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1-(2,2,2-trifluoroethylamino)cyclohexane-1-carbonitrile is sourced from PubChem (CID 54892775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).