About 1-ethyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid
1-ethyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid (PubChem CID 54893034) has the molecular formula C10H17F3N2O2
and a molecular weight of 254.25 g/mol. Its IUPAC name is 1-ethyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-ethyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid |
| PubChem CID | 54893034 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-ethyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid |
| SMILES | CCN1CCC(NCC(F)(F)F)(C(=O)O)CC1 |
| InChI | InChI=1S/C10H17F3N2O2/c1-2-15-5-3-9(4-6-15,8(16)17)14-7-10(11,12)13/h14H,2-7H2,1H3,(H,16,17) |
| InChIKey | ZZALRRUBNBMOIK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid?
The IUPAC name of 1-ethyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid (CID 54893034) is 1-ethyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid.
What is the SMILES notation for 1-ethyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid?
The canonical SMILES for 1-ethyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid is CCN1CCC(NCC(F)(F)F)(C(=O)O)CC1.
What is the InChIKey of 1-ethyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid?
The InChIKey is ZZALRRUBNBMOIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2O2/c1-2-15-5-3-9(4-6-15,8(16)17)14-7-10(11,12)13/h14H,2-7H2,1H3,(H,16,17).
What are the key properties of 1-ethyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid?
1-ethyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid has a molecular weight of 254.25 g/mol, XLogP of 1.08, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid is sourced from PubChem (CID 54893034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).