About methyl 6-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridazine-3-carboxylate
methyl 6-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridazine-3-carboxylate (PubChem CID 54893549) has the molecular formula C11H12N4O2S
and a molecular weight of 264.31 g/mol. Its IUPAC name is methyl 6-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridazine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridazine-3-carboxylate |
| PubChem CID | 54893549 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | methyl 6-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NCc2nc(C)cs2)nn1 |
| InChI | InChI=1S/C11H12N4O2S/c1-7-6-18-10(13-7)5-12-9-4-3-8(14-15-9)11(16)17-2/h3-4,6H,5H2,1-2H3,(H,12,15) |
| InChIKey | CJEIFUUPOIOOMY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 6-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridazine-3-carboxylate?
The IUPAC name of methyl 6-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridazine-3-carboxylate (CID 54893549) is methyl 6-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridazine-3-carboxylate.
What is the SMILES notation for methyl 6-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridazine-3-carboxylate?
The canonical SMILES for methyl 6-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridazine-3-carboxylate is COC(=O)c1ccc(NCc2nc(C)cs2)nn1.
What is the InChIKey of methyl 6-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridazine-3-carboxylate?
The InChIKey is CJEIFUUPOIOOMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2S/c1-7-6-18-10(13-7)5-12-9-4-3-8(14-15-9)11(16)17-2/h3-4,6H,5H2,1-2H3,(H,12,15).
What are the key properties of methyl 6-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridazine-3-carboxylate?
methyl 6-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridazine-3-carboxylate has a molecular weight of 264.31 g/mol, XLogP of 1.64, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridazine-3-carboxylate is sourced from PubChem (CID 54893549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).