C14H16F2N2 — CID 54893948
2-(cyclohexylamino)-2-(2,4-difluorophenyl)acetonitrile (PubChem CID 54893948) has the molecular formula C14H16F2N2 and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-(cyclohexylamino)-2-(2,4-difluorophenyl)acetonitrile.
| Compound Name | 2-(cyclohexylamino)-2-(2,4-difluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 54893948 |
| Molecular Formula | C14H16F2N2 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-(cyclohexylamino)-2-(2,4-difluorophenyl)acetonitrile |
| SMILES | N#CC(NC1CCCCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H16F2N2/c15-10-6-7-12(13(16)8-10)14(9-17)18-11-4-2-1-3-5-11/h6-8,11,14,18H,1-5H2 |
| InChIKey | TXDRZDIPFTXKCY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |