C15H20BrNO2 — CID 54894117
methyl 2-(4-bromophenyl)-2-(cyclopropylmethylamino)butanoate (PubChem CID 54894117) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is methyl 2-(4-bromophenyl)-2-(cyclopropylmethylamino)butanoate.
| Compound Name | methyl 2-(4-bromophenyl)-2-(cyclopropylmethylamino)butanoate |
|---|---|
| PubChem CID | 54894117 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | methyl 2-(4-bromophenyl)-2-(cyclopropylmethylamino)butanoate |
| SMILES | CCC(NCC1CC1)(C(=O)OC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H20BrNO2/c1-3-15(14(18)19-2,17-10-11-4-5-11)12-6-8-13(16)9-7-12/h6-9,11,17H,3-5,10H2,1-2H3 |
| InChIKey | XTCBPZHCWOBLEU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |