C14H21N5 — CID 54895563
N,N-dimethyl-4-[1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]ethyl]aniline (PubChem CID 54895563) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is N,N-dimethyl-4-[1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]ethyl]aniline.
| Compound Name | N,N-dimethyl-4-[1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]ethyl]aniline |
|---|---|
| PubChem CID | 54895563 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | N,N-dimethyl-4-[1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]ethyl]aniline |
| SMILES | CC(NCc1nncn1C)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C14H21N5/c1-11(15-9-14-17-16-10-19(14)4)12-5-7-13(8-6-12)18(2)3/h5-8,10-11,15H,9H2,1-4H3 |
| InChIKey | YVUBLWVBCKSBEF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|