About 3-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitroaniline
3-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitroaniline (PubChem CID 54895858) has the molecular formula C10H10FN5O2
and a molecular weight of 251.22 g/mol. Its IUPAC name is 3-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitroaniline.
Molecular Properties
| Compound Name | 3-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitroaniline |
| PubChem CID | 54895858 |
| Molecular Formula | C10H10FN5O2 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 3-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitroaniline |
| SMILES | Cn1cnnc1CNc1cc(F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H10FN5O2/c1-15-6-13-14-10(15)5-12-8-2-7(11)3-9(4-8)16(17)18/h2-4,6,12H,5H2,1H3 |
| InChIKey | XNBHKQPEHUZGKZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitroaniline?
The IUPAC name of 3-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitroaniline (CID 54895858) is 3-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitroaniline.
What is the SMILES notation for 3-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitroaniline?
The canonical SMILES for 3-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitroaniline is Cn1cnnc1CNc1cc(F)cc([N+](=O)[O-])c1.
What is the InChIKey of 3-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitroaniline?
The InChIKey is XNBHKQPEHUZGKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FN5O2/c1-15-6-13-14-10(15)5-12-8-2-7(11)3-9(4-8)16(17)18/h2-4,6,12H,5H2,1H3.
What are the key properties of 3-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitroaniline?
3-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitroaniline has a molecular weight of 251.22 g/mol, XLogP of 1.47, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-5-nitroaniline is sourced from PubChem (CID 54895858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).