About ethyl 2-[propyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]acetate
ethyl 2-[propyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]acetate (PubChem CID 54899007) has the molecular formula C12H20N4O3
and a molecular weight of 268.32 g/mol. Its IUPAC name is ethyl 2-[propyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[propyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]acetate |
| PubChem CID | 54899007 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | ethyl 2-[propyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]acetate |
| SMILES | CCCN(CC(=O)OCC)C(=O)CCn1cncn1 |
| InChI | InChI=1S/C12H20N4O3/c1-3-6-15(8-12(18)19-4-2)11(17)5-7-16-10-13-9-14-16/h9-10H,3-8H2,1-2H3 |
| InChIKey | MOLMTCYLIKRLGW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[propyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[propyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]acetate?
The IUPAC name of ethyl 2-[propyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]acetate (CID 54899007) is ethyl 2-[propyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]acetate.
What is the SMILES notation for ethyl 2-[propyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]acetate?
The canonical SMILES for ethyl 2-[propyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]acetate is CCCN(CC(=O)OCC)C(=O)CCn1cncn1.
What is the InChIKey of ethyl 2-[propyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]acetate?
The InChIKey is MOLMTCYLIKRLGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O3/c1-3-6-15(8-12(18)19-4-2)11(17)5-7-16-10-13-9-14-16/h9-10H,3-8H2,1-2H3.
What are the key properties of ethyl 2-[propyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]acetate?
ethyl 2-[propyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]acetate has a molecular weight of 268.32 g/mol, XLogP of 0.47, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[propyl-[3-(1,2,4-triazol-1-yl)propanoyl]amino]acetate is sourced from PubChem (CID 54899007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).