About methyl 3-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]-ethylamino]propanoate
methyl 3-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]-ethylamino]propanoate (PubChem CID 54899031) has the molecular formula C13H21N3O3
and a molecular weight of 267.33 g/mol. Its IUPAC name is methyl 3-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]-ethylamino]propanoate.
Molecular Properties
| Compound Name | methyl 3-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]-ethylamino]propanoate |
| PubChem CID | 54899031 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | methyl 3-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]-ethylamino]propanoate |
| SMILES | CCN(CCC(=O)OC)C(=O)Cn1nc(C)cc1C |
| InChI | InChI=1S/C13H21N3O3/c1-5-15(7-6-13(18)19-4)12(17)9-16-11(3)8-10(2)14-16/h8H,5-7,9H2,1-4H3 |
| InChIKey | YYWFIQSIHKDQKS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]-ethylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]-ethylamino]propanoate?
The IUPAC name of methyl 3-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]-ethylamino]propanoate (CID 54899031) is methyl 3-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]-ethylamino]propanoate.
What is the SMILES notation for methyl 3-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]-ethylamino]propanoate?
The canonical SMILES for methyl 3-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]-ethylamino]propanoate is CCN(CCC(=O)OC)C(=O)Cn1nc(C)cc1C.
What is the InChIKey of methyl 3-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]-ethylamino]propanoate?
The InChIKey is YYWFIQSIHKDQKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O3/c1-5-15(7-6-13(18)19-4)12(17)9-16-11(3)8-10(2)14-16/h8H,5-7,9H2,1-4H3.
What are the key properties of methyl 3-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]-ethylamino]propanoate?
methyl 3-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]-ethylamino]propanoate has a molecular weight of 267.33 g/mol, XLogP of 0.91, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[2-(3,5-dimethylpyrazol-1-yl)acetyl]-ethylamino]propanoate is sourced from PubChem (CID 54899031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).