About 3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]propanoic acid
3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]propanoic acid (PubChem CID 54899462) has the molecular formula C12H21N3O3
and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]propanoic acid.
Molecular Properties
| Compound Name | 3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]propanoic acid |
| PubChem CID | 54899462 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)Cc1noc(C(C)(C)C)n1 |
| InChI | InChI=1S/C12H21N3O3/c1-5-15(7-6-10(16)17)8-9-13-11(18-14-9)12(2,3)4/h5-8H2,1-4H3,(H,16,17) |
| InChIKey | MUDXVAOSROIHCG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]propanoic acid?
The IUPAC name of 3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]propanoic acid (CID 54899462) is 3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]propanoic acid.
What is the SMILES notation for 3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]propanoic acid?
The canonical SMILES for 3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]propanoic acid is CCN(CCC(=O)O)Cc1noc(C(C)(C)C)n1.
What is the InChIKey of 3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]propanoic acid?
The InChIKey is MUDXVAOSROIHCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O3/c1-5-15(7-6-10(16)17)8-9-13-11(18-14-9)12(2,3)4/h5-8H2,1-4H3,(H,16,17).
What are the key properties of 3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]propanoic acid?
3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]propanoic acid has a molecular weight of 255.32 g/mol, XLogP of 1.66, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]propanoic acid is sourced from PubChem (CID 54899462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).