About N-butan-2-yl-3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]propanamide
N-butan-2-yl-3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]propanamide (PubChem CID 54900811) has the molecular formula C15H26N2OS
and a molecular weight of 282.45 g/mol. Its IUPAC name is N-butan-2-yl-3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]propanamide.
Molecular Properties
| Compound Name | N-butan-2-yl-3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]propanamide |
| PubChem CID | 54900811 |
| Molecular Formula | C15H26N2OS |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | N-butan-2-yl-3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]propanamide |
| SMILES | CCC(C)NC(=O)CCNC(C)c1cc(C)sc1C |
| InChI | InChI=1S/C15H26N2OS/c1-6-10(2)17-15(18)7-8-16-12(4)14-9-11(3)19-13(14)5/h9-10,12,16H,6-8H2,1-5H3,(H,17,18) |
| InChIKey | DMFKOCJDSARVKA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butan-2-yl-3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]propanamide?
The IUPAC name of N-butan-2-yl-3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]propanamide (CID 54900811) is N-butan-2-yl-3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]propanamide.
What is the SMILES notation for N-butan-2-yl-3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]propanamide?
The canonical SMILES for N-butan-2-yl-3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]propanamide is CCC(C)NC(=O)CCNC(C)c1cc(C)sc1C.
What is the InChIKey of N-butan-2-yl-3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]propanamide?
The InChIKey is DMFKOCJDSARVKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2OS/c1-6-10(2)17-15(18)7-8-16-12(4)14-9-11(3)19-13(14)5/h9-10,12,16H,6-8H2,1-5H3,(H,17,18).
What are the key properties of N-butan-2-yl-3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]propanamide?
N-butan-2-yl-3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]propanamide has a molecular weight of 282.45 g/mol, XLogP of 3.32, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-3-[1-(2,5-dimethylthiophen-3-yl)ethylamino]propanamide is sourced from PubChem (CID 54900811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).