C12H17N3O3 — CID 54901193
ethyl 2-[propan-2-yl(pyrazine-2-carbonyl)amino]acetate (PubChem CID 54901193) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is ethyl 2-[propan-2-yl(pyrazine-2-carbonyl)amino]acetate.
| Compound Name | ethyl 2-[propan-2-yl(pyrazine-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 54901193 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | ethyl 2-[propan-2-yl(pyrazine-2-carbonyl)amino]acetate |
| SMILES | CCOC(=O)CN(C(=O)c1cnccn1)C(C)C |
| InChI | InChI=1S/C12H17N3O3/c1-4-18-11(16)8-15(9(2)3)12(17)10-7-13-5-6-14-10/h5-7,9H,4,8H2,1-3H3 |
| InChIKey | AIRALNUYLWXXDJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |