C7H14N6O3S — CID 54901713
2-(3-amino-1,2,4-triazol-1-yl)-N-[2-(methanesulfonamido)ethyl]acetamide (PubChem CID 54901713) has the molecular formula C7H14N6O3S and a molecular weight of 262.29 g/mol. Its IUPAC name is 2-(3-amino-1,2,4-triazol-1-yl)-N-[2-(methanesulfonamido)ethyl]acetamide.
| Compound Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-[2-(methanesulfonamido)ethyl]acetamide |
|---|---|
| PubChem CID | 54901713 |
| Molecular Formula | C7H14N6O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-[2-(methanesulfonamido)ethyl]acetamide |
| SMILES | CS(=O)(=O)NCCNC(=O)Cn1cnc(N)n1 |
| InChI | InChI=1S/C7H14N6O3S/c1-17(15,16)11-3-2-9-6(14)4-13-5-10-7(8)12-13/h5,11H,2-4H2,1H3,(H2,8,12)(H,9,14) |
| InChIKey | MIGKYTZDFYRBRU-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|