About 1-(4-acetylpiperazin-1-yl)-2-(3-amino-1,2,4-triazol-1-yl)ethanone
1-(4-acetylpiperazin-1-yl)-2-(3-amino-1,2,4-triazol-1-yl)ethanone (PubChem CID 54901753) has the molecular formula C10H16N6O2
and a molecular weight of 252.28 g/mol. Its IUPAC name is 1-(4-acetylpiperazin-1-yl)-2-(3-amino-1,2,4-triazol-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-acetylpiperazin-1-yl)-2-(3-amino-1,2,4-triazol-1-yl)ethanone |
| PubChem CID | 54901753 |
| Molecular Formula | C10H16N6O2 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-(4-acetylpiperazin-1-yl)-2-(3-amino-1,2,4-triazol-1-yl)ethanone |
| SMILES | CC(=O)N1CCN(C(=O)Cn2cnc(N)n2)CC1 |
| InChI | InChI=1S/C10H16N6O2/c1-8(17)14-2-4-15(5-3-14)9(18)6-16-7-12-10(11)13-16/h7H,2-6H2,1H3,(H2,11,13) |
| InChIKey | PMZZZEVKFGJSKW-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-acetylpiperazin-1-yl)-2-(3-amino-1,2,4-triazol-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-acetylpiperazin-1-yl)-2-(3-amino-1,2,4-triazol-1-yl)ethanone?
The IUPAC name of 1-(4-acetylpiperazin-1-yl)-2-(3-amino-1,2,4-triazol-1-yl)ethanone (CID 54901753) is 1-(4-acetylpiperazin-1-yl)-2-(3-amino-1,2,4-triazol-1-yl)ethanone.
What is the SMILES notation for 1-(4-acetylpiperazin-1-yl)-2-(3-amino-1,2,4-triazol-1-yl)ethanone?
The canonical SMILES for 1-(4-acetylpiperazin-1-yl)-2-(3-amino-1,2,4-triazol-1-yl)ethanone is CC(=O)N1CCN(C(=O)Cn2cnc(N)n2)CC1.
What is the InChIKey of 1-(4-acetylpiperazin-1-yl)-2-(3-amino-1,2,4-triazol-1-yl)ethanone?
The InChIKey is PMZZZEVKFGJSKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N6O2/c1-8(17)14-2-4-15(5-3-14)9(18)6-16-7-12-10(11)13-16/h7H,2-6H2,1H3,(H2,11,13).
What are the key properties of 1-(4-acetylpiperazin-1-yl)-2-(3-amino-1,2,4-triazol-1-yl)ethanone?
1-(4-acetylpiperazin-1-yl)-2-(3-amino-1,2,4-triazol-1-yl)ethanone has a molecular weight of 252.28 g/mol, XLogP of -1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-acetylpiperazin-1-yl)-2-(3-amino-1,2,4-triazol-1-yl)ethanone is sourced from PubChem (CID 54901753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).